Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-(Perfluorotetradecyl)ethanol |
|---|---|
| Synonyms | 1,1,2,2-Tetrahydroperfluoro-1-Hexadecanol; 1-Hexadecanol, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-Nonacosafluoro-; 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-Nonacosafluorohexadecanol |
| Molecular Structure |  |
| Molecular Formula | C16H5F29O |
| Molecular Weight | 764.17 |
| CAS Registry Number | 60699-51-6 |
| EINECS | 262-382-7 |
| SMILES | C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)CO |
| InChI | 1S/C16H5F29O/c17-3(18,1-2-46)4(19,20)5(21,22)6(23,24)7(25,26)8(27,28)9(29,30)10(31,32)11(33,34)12(35,36)13(37,38)14(39,40)15(41,42)16(43,44)45/h46H,1-2H2 |
| InChIKey | ZDUOTHMDVYXZBS-UHFFFAOYSA-N |
| Density | 1.703g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.79°C at 760 mmHg (Cal.) |
| Flash point | 126.037°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(Perfluorotetradecyl)ethanol |