Online Database of Chemicals from Around the World
| Name | Isopropyl Diphenyl Phosphate |
|---|---|
| Synonyms | Isopropyl Diphenyl Phosphate; Phosphoric Acid Isopropyl Diphenyl Ester |
| Molecular Structure |  |
| Molecular Formula | C15H17O4P |
| Molecular Weight | 292.27 |
| CAS Registry Number | 60763-39-5 |
| EINECS | 262-411-3 |
| SMILES | C1=CC=CC=C1O[P](=O)(OC(C)C)OC2=CC=CC=C2 |
| InChI | 1S/C15H17O4P/c1-13(2)17-20(16,18-14-9-5-3-6-10-14)19-15-11-7-4-8-12-15/h3-13H,1-2H3 |
| InChIKey | YDICVVYPXSZSFA-UHFFFAOYSA-N |
| Density | 1.189g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.24°C at 760 mmHg (Cal.) |
| Flash point | 178.108°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isopropyl Diphenyl Phosphate |
