|
CAS#: 60815-41-0 Product: L-Tyrosyl-L-Tryptophan No suppilers available for the product. |
| Name | L-Tyrosyl-L-Tryptophan |
|---|---|
| Synonyms | H-TYR-TRP-OH; L-Tyr-L-Trp; Tyrosyltryptophan |
| Molecular Structure | ![]() |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.40 |
| CAS Registry Number | 60815-41-0 |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)O)NC(=O)[C@H](CC3=CC=C(C=C3)O)N |
| InChI | 1S/C20H21N3O4/c21-16(9-12-5-7-14(24)8-6-12)19(25)23-18(20(26)27)10-13-11-22-17-4-2-1-3-15(13)17/h1-8,11,16,18,22,24H,9-10,21H2,(H,23,25)(H,26,27)/t16-,18-/m0/s1 |
| InChIKey | BMPPMAOOKQJYIP-WMZOPIPTSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 747.9±60.0°C at 760 mmHg (Cal.) |
| Flash point | 406.1±32.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-Tyrosyl-L-Tryptophan |