Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-Hydroxybenzenesulphonic Acid |
|---|---|
| Synonyms | Benzenesulfonic Acid, Hydroxy-; Benzenesulfonic Acid, 2-Hydroxy-; Benzenesulfonic Acid, O-Hydroxy- |
| Molecular Structure |  |
| Molecular Formula | C6H6O4S |
| Molecular Weight | 174.17 |
| CAS Registry Number | 609-46-1 |
| EINECS | 210-191-4 |
| SMILES | C1=CC=CC(=C1[S](O)(=O)=O)O |
| InChI | 1S/C6H6O4S/c7-5-3-1-2-4-6(5)11(8,9)10/h1-4,7H,(H,8,9,10) |
| InChIKey | IULJSGIJJZZUMF-UHFFFAOYSA-N |
| Density | 1.574g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxybenzenesulphonic Acid |