Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-Chloro-4-(Chloromethyl)-2,3,5,6-Tetrafluoro-Benzene |
|---|---|
| Synonyms | C144 |
| Molecular Structure |  |
| Molecular Formula | C7H2Cl2F4 |
| Molecular Weight | 232.99 |
| CAS Registry Number | 60903-83-5 |
| SMILES | C(Cl)C1=C(F)C(=C(Cl)C(=C1F)F)F |
| InChI | 1S/C7H2Cl2F4/c8-1-2-4(10)6(12)3(9)7(13)5(2)11/h1H2 |
| InChIKey | JFJHGLHUIPYFAE-UHFFFAOYSA-N |
| Density | 1.597g/cm3 (Cal.) |
|---|---|
| Boiling point | 193.426°C at 760 mmHg (Cal.) |
| Flash point | 78.958°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-4-(Chloromethyl)-2,3,5,6-Tetrafluoro-Benzene |