Online Database of Chemicals from Around the World
| Name | 4-(2,2-Dichloro-1,1-Difluoroethoxy)Aniline |
|---|---|
| Synonyms | 4-(2,2-Dichloro-1,1-Difluoro-Ethoxy)Aniline; [4-(2,2-Dichloro-1,1-Difluoro-Ethoxy)Phenyl]Amine |
| Molecular Structure |  |
| Molecular Formula | C8H7Cl2F2NO |
| Molecular Weight | 242.05 |
| CAS Registry Number | 60984-93-2 |
| EINECS | 262-547-3 |
| SMILES | C1=C(OC(F)(F)C(Cl)Cl)C=CC(=C1)N |
| InChI | 1S/C8H7Cl2F2NO/c9-7(10)8(11,12)14-6-3-1-5(13)2-4-6/h1-4,7H,13H2 |
| InChIKey | MQJBOCAFCBRKTK-UHFFFAOYSA-N |
| Density | 1.455g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.636°C at 760 mmHg (Cal.) |
| Flash point | 129.572°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2,2-Dichloro-1,1-Difluoroethoxy)Aniline |
