Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 3,4,5-Trimethoxybenzothioamide |
|---|---|
| Synonyms | 3,4,5-Trimethoxythiobenzamide; Zinc02001010; Benzamide, Thio-3,4,5-Trimethoxy- |
| Molecular Structure |  |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 |
| CAS Registry Number | 60987-94-2 |
| SMILES | C1=C(C(N)=S)C=C(C(=C1OC)OC)OC |
| InChI | 1S/C10H13NO3S/c1-12-7-4-6(10(11)15)5-8(13-2)9(7)14-3/h4-5H,1-3H3,(H2,11,15) |
| InChIKey | FCQGHVXXICVSIF-UHFFFAOYSA-N |
| Density | 1.209g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.489°C at 760 mmHg (Cal.) |
| Flash point | 169.398°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4,5-Trimethoxybenzothioamide |