| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 2,3-Bis(Nitrooxy)Succinic Acid |
|---|---|
| Synonyms | 2,3-Dinitrooxysuccinic Acid; 2,3-Bis(Nitrooxy)Succinic Acid; Butanedioic Acid, 2,3-Bis(Nitrooxy)- |
| Molecular Structure | ![]() |
| Molecular Formula | C4H4N2O10 |
| Molecular Weight | 240.08 |
| CAS Registry Number | 610-20-8 |
| EINECS | 210-211-1 |
| SMILES | O=[N+]([O-])OC(C(=O)O)C(O[N+](=O)[O-])C(=O)O |
| InChI | 1S/C4H4N2O10/c7-3(8)1(15-5(11)12)2(4(9)10)16-6(13)14/h1-2H,(H,7,8)(H,9,10) |
| InChIKey | YIHNLKXIMXGECA-UHFFFAOYSA-N |
| Density | 1.954g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.15°C at 760 mmHg (Cal.) |
| Flash point | 165.565°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Bis(Nitrooxy)Succinic Acid |