Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl N-methyl-D-alloisoleucinate |
|---|---|
| Synonyms | (2R,3S)-methyl 3-methyl-2-(methylamino)pentanoate |
| Molecular Structure |  |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 |
| CAS Registry Number | 610800-54-9 |
| SMILES | CC[C@H](C)[C@H](C(=O)OC)NC |
| InChI | 1S/C8H17NO2/c1-5-6(2)7(9-3)8(10)11-4/h6-7,9H,5H2,1-4H3/t6-,7+/m0/s1 |
| InChIKey | LAWYTLVUHMZCFE-NKWVEPMBSA-N |
| Density | 0.917g/cm3 (Cal.) |
|---|---|
| Boiling point | 190.739°C at 760 mmHg (Cal.) |
| Flash point | 69.157°C (Cal.) |
| Refractive index | 1.425 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl N-methyl-D-alloisoleucinate |