|
CAS#: 611226-88-1 Product: 1-[Dimethyl(2-methyl-2-propanyl)silyl]-5-(3-fluorophenyl)-1H-pyrrolo[2,3-b]pyridine No suppilers available for the product. |
| Name | 1-[Dimethyl(2-methyl-2-propanyl)silyl]-5-(3-fluorophenyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| Synonyms | 1H-Pyrrol |
| Molecular Structure | ![]() |
| Molecular Formula | C19H23FN2Si |
| Molecular Weight | 326.48 |
| CAS Registry Number | 611226-88-1 |
| SMILES | CC(C)(C)[Si](C)(C)n1ccc2c1ncc(c2)c3cccc(c3)F |
| InChI | 1S/C19H23FN2Si/c1-19(2,3)23(4,5)22-10-9-15-11-16(13-21-18(15)22)14-7-6-8-17(20)12-14/h6-13H,1-5H3 |
| InChIKey | MVQCGFBMCWYOBY-UHFFFAOYSA-N |
| Density | 1.048g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.989°C at 760 mmHg (Cal.) |
| Flash point | 178.773°C (Cal.) |
| Refractive index | 1.542 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[Dimethyl(2-methyl-2-propanyl)silyl]-5-(3-fluorophenyl)-1H-pyrrolo[2,3-b]pyridine |