Online Database of Chemicals from Around the World
|
CAS#: 61125-52-8 Product: Cyclobis(N-Methylphenylalanine) No suppilers available for the product. |
| Name | Cyclobis(N-Methylphenylalanine) |
|---|---|
| Synonyms | (3S,6S)-3,6-Bis(Benzyl)-1,4-Dimethyl-Piperazine-2,5-Quinone; 2,5-Piperazinedione, 1,4-Dimethyl-3,6-Bis(Phenylmethyl)-, (3S-Cis)-; Cyclobis(N-Methylphenylalanine) |
| Molecular Structure |  |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 |
| CAS Registry Number | 61125-52-8 |
| SMILES | [C@H]1(N(C([C@@H](N(C1=O)C)CC2=CC=CC=C2)=O)C)CC3=CC=CC=C3 |
| InChI | 1S/C20H22N2O2/c1-21-17(13-15-9-5-3-6-10-15)20(24)22(2)18(19(21)23)14-16-11-7-4-8-12-16/h3-12,17-18H,13-14H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | KNKXKVUFAHAVOL-ROUUACIJSA-N |
| Density | 1.159g/cm3 (Cal.) |
|---|---|
| Boiling point | 534.628°C at 760 mmHg (Cal.) |
| Flash point | 243.192°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cyclobis(N-Methylphenylalanine) |