Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Bide Pharmatech Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 4006-147-117 | |||
|
sales@bidepharmatech.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2007 | ||||
| Name | 2-((2-Aminobenzoyl)amino)benzoic acid |
|---|---|
| Synonyms | 2-[[(2-Aminophenyl)-Oxomethyl]Amino]Benzoic Acid; 2-[(2-Aminophenyl)Carbonylamino]Benzoic Acid; Oprea1_836614 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 |
| CAS Registry Number | 612-34-0 |
| EINECS | 210-304-7 |
| SMILES | C1=CC=CC(=C1NC(=O)C2=C(N)C=CC=C2)C(O)=O |
| InChI | 1S/C14H12N2O3/c15-11-7-3-1-5-9(11)13(17)16-12-8-4-2-6-10(12)14(18)19/h1-8H,15H2,(H,16,17)(H,18,19) |
| InChIKey | FECNOIODIVNEKI-UHFFFAOYSA-N |
| Density | 1.399g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.559°C at 760 mmHg (Cal.) |
| Flash point | 197.866°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-((2-Aminobenzoyl)amino)benzoic acid |