Online Database of Chemicals from Around the World
|
CAS#: 612-98-6 Product: Nitrosobenzylphenylamine No suppilers available for the product. |
| Name | Nitrosobenzylphenylamine |
|---|---|
| Synonyms | N-(Benzyl)-N-Phenyl-Nitrous Amide; 3-12-00-02335 (Beilstein Handbook Reference); Ai3-00487 |
| Molecular Structure |  |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 |
| CAS Registry Number | 612-98-6 |
| SMILES | C1=C(C=CC=C1)N(CC2=CC=CC=C2)N=O |
| InChI | 1S/C13H12N2O/c16-14-15(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10H,11H2 |
| InChIKey | BCIBCBXFXGKGBL-UHFFFAOYSA-N |
| Density | 1.074g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.887°C at 760 mmHg (Cal.) |
| Flash point | 185.968°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Nitrosobenzylphenylamine |