Online Database of Chemicals from Around the World
|
CAS#: 6120-10-1 Product: 4-Dimethylamino-3,5-Xylenol No suppilers available for the product. |
| Name | 4-Dimethylamino-3,5-Xylenol |
|---|---|
| Synonyms | 4-Dimethylamino-3,5-Dimethyl-Phenol; 4-(Dimethylamino)-3,5-Dimethylphenol; 4-(Dimethylamino)-3,5-Xylenol |
| Molecular Structure |  |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.23 |
| CAS Registry Number | 6120-10-1 |
| EINECS | 228-089-3 |
| SMILES | C1=C(C(=C(C=C1O)C)N(C)C)C |
| InChI | 1S/C10H15NO/c1-7-5-9(12)6-8(2)10(7)11(3)4/h5-6,12H,1-4H3 |
| InChIKey | GZPBVLUEICLBOA-UHFFFAOYSA-N |
| Density | 1.043g/cm3 (Cal.) |
|---|---|
| Boiling point | 275.557°C at 760 mmHg (Cal.) |
| Flash point | 128.331°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Dimethylamino-3,5-Xylenol |