Online Database of Chemicals from Around the World
|
CAS#: 61259-58-3 Product: 4H-Benzo[a]Quinolizin-4-One No suppilers available for the product. |
| Name | 4H-Benzo[a]Quinolizin-4-One |
|---|---|
| Synonyms | 4-Pyrido[6,1-A]Isoquinolinone; Nsc367099 |
| Molecular Structure | ![CAS#: 61259-58-3， 4H-Benzo[a]Quinolizin-4-One](/moreStructures/61259-58-3.gif) |
| Molecular Formula | C13H9NO |
| Molecular Weight | 195.22 |
| CAS Registry Number | 61259-58-3 |
| SMILES | C1=CC=CC2=C1C=CN3C(=O)C=CC=C23 |
| InChI | 1S/C13H9NO/c15-13-7-3-6-12-11-5-2-1-4-10(11)8-9-14(12)13/h1-9H |
| InChIKey | GVSAARYACCSJNI-UHFFFAOYSA-N |
| Density | 1.297g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.037°C at 760 mmHg (Cal.) |
| Flash point | 220.808°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4H-Benzo[a]Quinolizin-4-One |