|
CAS#: 61262-94-0 Product: (5S)-5,6-Dihydro-5,6-Dihydroxy-6-Methylheptan-2-One Acetonide No suppilers available for the product. |
| Name | (5S)-5,6-Dihydro-5,6-Dihydroxy-6-Methylheptan-2-One Acetonide |
|---|---|
| Synonyms | Zinc04262040 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 |
| CAS Registry Number | 61262-94-0 |
| SMILES | [C@@H]1(C(OC(O1)(C)C)(C)C)CCC(C)=O |
| InChI | 1S/C11H20O3/c1-8(12)6-7-9-10(2,3)14-11(4,5)13-9/h9H,6-7H2,1-5H3/t9-/m0/s1 |
| InChIKey | AOIFUGIGKLNKKW-VIFPVBQESA-N |
| Density | 0.93g/cm3 (Cal.) |
|---|---|
| Boiling point | 245.599°C at 760 mmHg (Cal.) |
| Flash point | 92.816°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (5S)-5,6-Dihydro-5,6-Dihydroxy-6-Methylheptan-2-One Acetonide |