| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Fluorochem Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Name | Di-1-Naphthylmethanone |
|---|---|
| Synonyms | 1-naphthyl ketone |
| Molecular Structure | ![]() |
| Molecular Formula | C21H14O |
| Molecular Weight | 282.34 |
| CAS Registry Number | 613-56-9 |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)C3=CC=CC4=CC=CC=C43 |
| InChI | 1S/C21H14O/c22-21(19-13-5-9-15-7-1-3-11-17(15)19)20-14-6-10-16-8-2-4-12-18(16)20/h1-14H |
| InChIKey | AZRQQTKALKINGP-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 485.7±14.0°C at 760 mmHg (Cal.) |
| Flash point | 216.0±15.1°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Noureddine Khiar, Manuel Pernía Leal, Raquel Navas, Juan Francisco Moya, María Victoria García Pérez and Inmaculada Fernández. P/S ligands derived from carbohydrates in Rh-catalyzed hydrosilylation of ketones, Org. Biomol. Chem., 2012, 10, 355. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Di-1-Naphthylmethanone |