Online Database of Chemicals from Around the World
|
CAS#: 61346-13-2 Product: 3-Methoxy-1a,9b-Dihydrophenanthro[9,10-b]Oxirene No suppilers available for the product. |
| Name | 3-Methoxy-1a,9b-Dihydrophenanthro[9,10-b]Oxirene |
|---|---|
| Molecular Structure | ![CAS#: 61346-13-2， 3-Methoxy-1a,9b-Dihydrophenanthro[9,10-b]Oxirene](/moreStructures/61346-13-2.gif) |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.26 |
| CAS Registry Number | 61346-13-2 |
| SMILES | C1=CC=CC3=C1C2OC2C4=C3C=CC(=C4)OC |
| InChI | 1S/C15H12O2/c1-16-9-6-7-11-10-4-2-3-5-12(10)14-15(17-14)13(11)8-9/h2-8,14-15H,1H3 |
| InChIKey | RLEPGBMNDCFEOI-UHFFFAOYSA-N |
| Density | 1.247g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.773°C at 760 mmHg (Cal.) |
| Flash point | 167.006°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methoxy-1a,9b-Dihydrophenanthro[9,10-b]Oxirene |