Online Database of Chemicals from Around the World
| Asinex Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
 |
+7 (495) 780-3415 / 780-3417 | |||
 |
lsadovenko@asinex.com, | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | [[(Phenylamino)Thioxomethyl]Amino]Methyl Diethyldithiocarbamate |
|---|---|
| Synonyms | Bim-0002304.P001; Mls000713485; Smr000272966 |
| Molecular Structure | ![CAS#: 6142-40-1， [[(Phenylamino)Thioxomethyl]Amino]Methyl Diethyldithiocarbamate](/moreStructures/6142-40-1.gif) |
| Molecular Formula | C15H12FN3O |
| Molecular Weight | 269.28 |
| CAS Registry Number | 6142-40-1 |
| EINECS | 228-137-3 |
| SMILES | C4=C(C3=CC2=NC1=C(CCC1)C(=O)N2N3)C=CC=C4F |
| InChI | 1S/C15H12FN3O/c16-10-4-1-3-9(7-10)13-8-14-17-12-6-2-5-11(12)15(20)19(14)18-13/h1,3-4,7-8,18H,2,5-6H2 |
| InChIKey | APYUCUXNXAMBGE-UHFFFAOYSA-N |
| Density | 1.492g/cm3 (Cal.) |
|---|---|
| Boiling point | 442.087°C at 760 mmHg (Cal.) |
| Flash point | 221.166°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [[(Phenylamino)Thioxomethyl]Amino]Methyl Diethyldithiocarbamate |