Online Database of Chemicals from Around the World
|
CAS#: 6144-04-3 Product: alpha-Methylstyrene Dimer No suppilers available for the product. |
| Name | alpha-Methylstyrene Dimer |
|---|---|
| Synonyms | Isopropenylbenzene; Isopropenylbenzene; Alpha-Methylstyrene Dimer; Benzene, (1-Methylethenyl)-, Dimer |
| Molecular Structure |  |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 |
| CAS Registry Number | 6144-04-3 |
| SMILES | C1=C(C(=C)C)C=CC=C1.C2=C(C(=C)C)C=CC=C2 |
| InChI | 1S/2C9H10/c2*1-8(2)9-6-4-3-5-7-9/h2*3-7H,1H2,2H3 |
| InChIKey | FZYCEURIEDTWNS-UHFFFAOYSA-N |
| Boiling point | 162.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 45.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Methylstyrene Dimer |