|
CAS#: 6147-14-4 Product: D-Mannose, Phenylhydrazone No suppilers available for the product. |
| Name | D-Mannose, Phenylhydrazone |
|---|---|
| Synonyms | 6-(Phenylhydrazinylidene)Hexane-1,2,3,4,5-Pentol; (6E)-6-(Phenylhydrazono)Hexane-1,2,3,4,5-Pentol; 6-(Phenylhydrazono)Hexane-1,2,3,4,5-Pentol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 |
| CAS Registry Number | 6147-14-4 |
| SMILES | C1=C(N\N=C\C(O)C(O)C(O)C(O)CO)C=CC=C1 |
| InChI | 1S/C12H18N2O5/c15-7-10(17)12(19)11(18)9(16)6-13-14-8-4-2-1-3-5-8/h1-6,9-12,14-19H,7H2/b13-6+ |
| InChIKey | MAKRUZFBMOBWLJ-AWNIVKPZSA-N |
| Density | 1.399g/cm3 (Cal.) |
|---|---|
| Boiling point | 620.471°C at 760 mmHg (Cal.) |
| Flash point | 329.049°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for D-Mannose, Phenylhydrazone |