Online Database of Chemicals from Around the World
|
CAS#: 615-11-2 Product: Furfuryl 2-Furoate No suppilers available for the product. |
| Name | Furfuryl 2-Furoate |
|---|---|
| Synonyms | 2-Furylmethyl Furan-2-Carboxylate; 2-Furancarboxylic Acid 2-Furylmethyl Ester; Furan-2-Carboxylic Acid 2-Furylmethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.17 |
| CAS Registry Number | 615-11-2 |
| EINECS | 210-408-2 |
| SMILES | C2=C(COC(=O)C1=CC=CO1)OC=C2 |
| InChI | 1S/C10H8O4/c11-10(9-4-2-6-13-9)14-7-8-3-1-5-12-8/h1-6H,7H2 |
| InChIKey | RRYLJIZZSKSDGN-UHFFFAOYSA-N |
| Density | 1.251g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.371°C at 760 mmHg (Cal.) |
| Flash point | 130.622°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Furfuryl 2-Furoate |