Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Formyl-6-(trifluoromethyl)isonicotinonitrile |
|---|---|
| Synonyms | 2-formyl-6-(trifluoromethyl)isonicotinonitrile |
| Molecular Structure |  |
| Molecular Formula | C8H3F3N2O |
| Molecular Weight | 200.12 |
| CAS Registry Number | 615580-27-3 |
| SMILES | c1c(cc(nc1C=O)C(F)(F)F)C#N |
| InChI | 1S/C8H3F3N2O/c9-8(10,11)7-2-5(3-12)1-6(4-14)13-7/h1-2,4H |
| InChIKey | RMIYJJYNXDICTF-UHFFFAOYSA-N |
| Density | 1.445g/cm3 (Cal.) |
|---|---|
| Boiling point | 188.372°C at 760 mmHg (Cal.) |
| Flash point | 67.725°C (Cal.) |
| Refractive index | 1.476 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Formyl-6-(trifluoromethyl)isonicotinonitrile |