Online Database of Chemicals from Around the World
|
CAS#: 61738-08-7 Product: 1-Fluoro-4-Methylchrysene No suppilers available for the product. |
| Name | 1-Fluoro-4-Methylchrysene |
|---|---|
| Synonyms | 1-Fluoro-4-Methyl-Chrysene; Brn 2531959; Chrysene, 1-Fluoro-4-Methyl- |
| Molecular Structure |  |
| Molecular Formula | C19H13F |
| Molecular Weight | 260.31 |
| CAS Registry Number | 61738-08-7 |
| SMILES | C1=CC3=C(C2=C1C=CC=C2)C=CC4=C(F)C=CC(=C34)C |
| InChI | 1S/C19H13F/c1-12-6-11-18(20)17-10-9-15-14-5-3-2-4-13(14)7-8-16(15)19(12)17/h2-11H,1H3 |
| InChIKey | XNAKJMFAMGFTJW-UHFFFAOYSA-N |
| Density | 1.226g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.275°C at 760 mmHg (Cal.) |
| Flash point | 199.415°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Fluoro-4-Methylchrysene |