Online Database of Chemicals from Around the World
|
CAS#: 61765-15-9 Product: 2-Chloro-3-Methylbenzothiazolium Trifluoromethanesulphonate No suppilers available for the product. |
| Name | 2-Chloro-3-Methylbenzothiazolium Trifluoromethanesulphonate |
|---|---|
| Synonyms | 2-Chloro-3-Methylbenzothiazolium Trifluoromethanesulphonate |
| Molecular Structure |  |
| Molecular Formula | C9H7ClF3NO3S2 |
| Molecular Weight | 333.73 |
| CAS Registry Number | 61765-15-9 |
| EINECS | 262-964-0 |
| SMILES | C1=CC=CC2=C1SC(=[N+]2C)Cl.O=[S](C(F)(F)F)(=O)[O-] |
| InChI | 1S/C8H7ClNS.CHF3O3S/c1-10-6-4-2-3-5-7(6)11-8(10)9;2-1(3,4)8(5,6)7/h2-5H,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | LWYSMSHCTRLEHY-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-3-Methylbenzothiazolium Trifluoromethanesulphonate |