Online Database of Chemicals from Around the World
|
CAS#: 61825-76-1 Product: (1R,2S,3R,6S)-6-Bromo-4-Cyclohexene-1,2,3-Triol No suppilers available for the product. |
| Name | (1R,2S,3R,6S)-6-Bromo-4-Cyclohexene-1,2,3-Triol |
|---|---|
| Synonyms | (1α,2β,3α,6α)-6-BROMO-4-CYCLOHEXENE-1,2,3-TRIOL |
| Molecular Structure |  |
| Molecular Formula | C6H9BrO3 |
| Molecular Weight | 209.04 |
| CAS Registry Number | 61825-76-1 |
| SMILES | C1=C[C@@H]([C@@H]([C@H]([C@@H]1O)O)O)Br |
| InChI | 1S/C6H9BrO3/c7-3-1-2-4(8)6(10)5(3)9/h1-6,8-10H/t3-,4+,5-,6-/m0/s1 |
| InChIKey | SUCAFEYLYXXTPF-FSIIMWSLSA-N |
| Density | 1.99g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.589°C at 760 mmHg (Cal.) |
| Flash point | 130.149°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2S,3R,6S)-6-Bromo-4-Cyclohexene-1,2,3-Triol |