Online Database of Chemicals from Around the World
|
CAS#: 61842-44-2 Product: 5-Hydroxyisophthaloyl Dichloride No suppilers available for the product. |
| Name | 5-Hydroxyisophthaloyl Dichloride |
|---|---|
| Synonyms | 5-Hydroxyisophthaloyl Dichloride; 1,3-Benzenedicarbonyl Dichloride, 5-Hydroxy- |
| Molecular Structure |  |
| Molecular Formula | C8H4Cl2O3 |
| Molecular Weight | 219.02 |
| CAS Registry Number | 61842-44-2 |
| EINECS | 263-271-6 |
| SMILES | C1=C(O)C=C(C=C1C(Cl)=O)C(Cl)=O |
| InChI | 1S/C8H4Cl2O3/c9-7(12)4-1-5(8(10)13)3-6(11)2-4/h1-3,11H |
| InChIKey | PVOFLWDXEXGWNT-UHFFFAOYSA-N |
| Density | 1.557g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.679°C at 760 mmHg (Cal.) |
| Flash point | 176.166°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Hydroxyisophthaloyl Dichloride |