|
CAS#: 618447-44-2 Product: 2-Methyl-2-propanyl (2S)-2-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)oxy]-3-methylbutanoate No suppilers available for the product. |
| Name | 2-Methyl-2-propanyl (2S)-2-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)oxy]-3-methylbutanoate |
|---|---|
| Synonyms | Butanoic |
| Molecular Structure | ![]() |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.35 |
| CAS Registry Number | 618447-44-2 |
| SMILES | CC(C)C(C(=O)OC(C)(C)C)ON1C(=O)c2ccccc2C1=O |
| InChI | 1S/C17H21NO5/c1-10(2)13(16(21)22-17(3,4)5)23-18-14(19)11-8-6-7-9-12(11)15(18)20/h6-10,13H,1-5H3/t13-/m0/s1 |
| InChIKey | JSUWPTFAHGCIFF-ZDUSSCGKSA-N |
| Density | 1.217g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.922°C at 760 mmHg (Cal.) |
| Flash point | 205.947°C (Cal.) |
| Refractive index | 1.547 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl (2S)-2-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)oxy]-3-methylbutanoate |