| Shandong Sihuan Pharmaceutical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.sdsihuanpharm.com | |||
![]() | +86 (0531) 8899-0216 | |||
![]() | fairouz@sdsihuanpharm.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2010 | ||||
| chemBlink Standard supplier since 2021 | ||||
| Name | 2,2-Dimethyl-5-(3-thienyl)-1,3-dioxane-4,6-dione |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H10O4S |
| Molecular Weight | 226.25 |
| CAS Registry Number | 61857-83-8 |
| SMILES | CC1(OC(=O)C(C(=O)O1)C2=CSC=C2)C |
| Solubility | 0.1493 mg/L (25 °C water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.535, Calc.* |
| Melting point | 132.02 °C |
| Boiling Point | 395.34 °C, 465.5±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 235.3±28.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dimethyl-5-(3-thienyl)-1,3-dioxane-4,6-dione |