|
CAS#: 61886-39-3 Product: 2-Chloro-1,4-Bis(1-Methylethoxy)Benzene No suppilers available for the product. |
| Name | 2-Chloro-1,4-Bis(1-Methylethoxy)Benzene |
|---|---|
| Synonyms | 2-Chloro-1,4-Diisopropoxy-Benzene; 2-Chloro-1,4-Diisopropoxybenzene; Benzene, 2-Chloro-1,4-Bis(1-Methylethoxy)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17ClO2 |
| Molecular Weight | 228.72 |
| CAS Registry Number | 61886-39-3 |
| EINECS | 263-289-4 |
| SMILES | C1=C(C=CC(=C1Cl)OC(C)C)OC(C)C |
| InChI | 1S/C12H17ClO2/c1-8(2)14-10-5-6-12(11(13)7-10)15-9(3)4/h5-9H,1-4H3 |
| InChIKey | KHJPWDHXQSXQRM-UHFFFAOYSA-N |
| Density | 1.058g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.123°C at 760 mmHg (Cal.) |
| Flash point | 90.984°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-1,4-Bis(1-Methylethoxy)Benzene |