|
CAS#: 6189-76-0 Product: Exo-1,7,7-Trimethylbicyclo[2.2.1]Hept-2-Yl Valerate No suppilers available for the product. |
| Name | Exo-1,7,7-Trimethylbicyclo[2.2.1]Hept-2-Yl Valerate |
|---|---|
| Synonyms | (1,7,7-Trimethylnorbornan-2-Yl) Pentanoate; Pentanoic Acid (1,7,7-Trimethyl-2-Norbornanyl) Ester; Valeric Acid 2-Bornyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 |
| CAS Registry Number | 6189-76-0 |
| EINECS | 228-233-5 |
| SMILES | C(C(OC1C2(C(C(C1)CC2)(C)C)C)=O)CCC |
| InChI | 1S/C15H26O2/c1-5-6-7-13(16)17-12-10-11-8-9-15(12,4)14(11,2)3/h11-12H,5-10H2,1-4H3 |
| InChIKey | ILUAVCBOWYHFAI-UHFFFAOYSA-N |
| Density | 0.978g/cm3 (Cal.) |
|---|---|
| Boiling point | 270.218°C at 760 mmHg (Cal.) |
| 136-137°C (Expl.) | |
| Flash point | 122.278°C (Cal.) |
| Refractive index | 1.459-1.465 (Expl.) |
| Market Analysis Reports |
| List of Reports Available for Exo-1,7,7-Trimethylbicyclo[2.2.1]Hept-2-Yl Valerate |