Online Database of Chemicals from Around the World
| Biosynth AG. | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (71) 858-2020 | |||
 |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Name | Tetrabromopyranthrene-8,16-Dione |
|---|---|
| Synonyms | 2,3,4,5-Tetrabromopyranthrene-8,16-Quinone; 8,16-Pyranthrenedione, Tetrabromo- |
| Molecular Structure |  |
| Molecular Formula | C30H10Br4O2 |
| Molecular Weight | 722.02 |
| CAS Registry Number | 61931-61-1 |
| EINECS | 263-328-5 |
| SMILES | C1=C8C6=C4C3=C1C2=CC=CC=C2C(C3=CC=C4C(=C7C5=C(C(=C(C=C5C(C(=C67)C=C8)=O)Br)Br)Br)Br)=O |
| InChI | 1S/C30H10Br4O2/c31-19-10-18-24(28(34)27(19)33)25-23-16(30(18)36)6-5-11-9-17-12-3-1-2-4-13(12)29(35)15-8-7-14(26(25)32)22(20(11)23)21(15)17/h1-10H |
| InChIKey | VWGVTTALJUVJRP-UHFFFAOYSA-N |
| Density | 2.139g/cm3 (Cal.) |
|---|---|
| Boiling point | 856.428°C at 760 mmHg (Cal.) |
| Flash point | 227.152°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tetrabromopyranthrene-8,16-Dione |