Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | 3-Deoxyhexulose |
|---|---|
| Synonyms | 3-Deoxyhexulose; D-Erythro-2-Hexulose, 3-Deoxy-; 3-Deoxy-D-Erythro-Hexulose |
| Molecular Structure |  |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 164.16 |
| CAS Registry Number | 6196-57-2 |
| SMILES | [C@@H](CC(CO)=O)(O)[C@H](O)CO |
| InChI | 1S/C6H12O5/c7-2-4(9)1-5(10)6(11)3-8/h5-8,10-11H,1-3H2/t5-,6+/m0/s1 |
| InChIKey | OXFWZSUJNURRMW-NTSWFWBYSA-N |
| Density | 1.422g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.644°C at 760 mmHg (Cal.) |
| Flash point | 250.739°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Deoxyhexulose |