Online Database of Chemicals from Around the World
|
CAS#: 62012-51-5 Product: 4,4',5,5'-Tetramethoxy-2,2'-Dimethyl-1,1'-Biphenyl No suppilers available for the product. |
| Name | 4,4',5,5'-Tetramethoxy-2,2'-Dimethyl-1,1'-Biphenyl |
|---|---|
| Synonyms | 1-(4,5-Dimethoxy-2-Methyl-Phenyl)-4,5-Dimethoxy-2-Methyl-Benzene; 4,4',5,5'-Tetramethoxy-2,2'-Dimethyl-1,1'-Biphenyl |
| Molecular Structure |  |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 |
| CAS Registry Number | 62012-51-5 |
| EINECS | 263-374-6 |
| SMILES | C1=C(OC)C(=CC(=C1C2=C(C=C(OC)C(=C2)OC)C)C)OC |
| InChI | 1S/C18H22O4/c1-11-7-15(19-3)17(21-5)9-13(11)14-10-18(22-6)16(20-4)8-12(14)2/h7-10H,1-6H3 |
| InChIKey | BYUPFZBHZMJFLY-UHFFFAOYSA-N |
| Density | 1.067g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.459°C at 760 mmHg (Cal.) |
| Flash point | 107.825°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4',5,5'-Tetramethoxy-2,2'-Dimethyl-1,1'-Biphenyl |