|
CAS#: 62046-37-1 Product: Sirmate No suppilers available for the product. |
| Name | Sirmate |
|---|---|
| Synonyms | N-Methylcarbamic Acid (2,3-Dichlorophenyl)Methyl Ester; N-Methylcarbamic Acid (2,3-Dichlorobenzyl) Ester; 2,3-Dichlorobenzyl, N-Methylcarbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.08 |
| CAS Registry Number | 62046-37-1 (2328-31-6) |
| SMILES | C1=CC=C(C(=C1Cl)Cl)COC(=O)NC |
| InChI | 1S/C9H9Cl2NO2/c1-12-9(13)14-5-6-3-2-4-7(10)8(6)11/h2-4H,5H2,1H3,(H,12,13) |
| InChIKey | SESJCOBCXSACPH-UHFFFAOYSA-N |
| Density | 1.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.256°C at 760 mmHg (Cal.) |
| Flash point | 166.234°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sirmate |