| Eburon Organics bvba | Belgium | Inquire | ||
|---|---|---|---|---|
![]() |
+32 (51) 335-068 | |||
![]() |
sales@eburon-organics.com | |||
| Chemical manufacturer | ||||
| Name | [4-(2-Bromoethyl)phenoxy](dimethyl)(2-methyl-2-propanyl)silane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H23BrOSi |
| Molecular Weight | 315.32 |
| CAS Registry Number | 620600-61-5 |
| SMILES | BrCCc1ccc(O[Si](C)(C(C)(C)C)C)cc1 |
| InChI | 1S/C14H23BrOSi/c1-14(2,3)17(4,5)16-13-8-6-12(7-9-13)10-11-15/h6-9H,10-11H2,1-5H3 |
| InChIKey | QLDTWFPECLLJRN-UHFFFAOYSA-N |
| Density | 1.135g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.401°C at 760 mmHg (Cal.) |
| Flash point | 138.502°C (Cal.) |
| Refractive index | 1.503 (Cal.) |
| (1) | Matthias Treu and Ulrich Jordis. [4-(2-Bromoethyl)phenoxy]-(1,1-dimethylethyl)dimethylsilane, Molbank 2002 Page M291 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for [4-(2-Bromoethyl)phenoxy](dimethyl)(2-methyl-2-propanyl)silane |