Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-(Methylamino)Azobenzene |
|---|---|
| Synonyms | N-Methyl-4-Phenylazo-Aniline; N-Methyl-4-Phenylazoaniline; Methyl-(4-Phenylazophenyl)Amine |
| Molecular Structure |  |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 |
| CAS Registry Number | 621-90-9 |
| SMILES | C2=C(N=NC1=CC=CC=C1)C=CC(=C2)NC |
| InChI | 1S/C13H13N3/c1-14-11-7-9-13(10-8-11)16-15-12-5-3-2-4-6-12/h2-10,14H,1H3 |
| InChIKey | DKOXITJAUZNAPK-UHFFFAOYSA-N |
| Density | 1.066g/cm3 (Cal.) |
|---|---|
| Melting point | 87°C (Expl.) |
| Boiling point | 370.166°C at 760 mmHg (Cal.) |
| Flash point | 177.67°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-(Methylamino)Azobenzene |