Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Quinolinamine 1-Oxide |
|---|---|
| Synonyms | 3-aminoquinoline 1-oxide; 3-Quinolinamine,1-oxide |
| Molecular Structure |  |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.17 |
| CAS Registry Number | 62141-03-1 |
| SMILES | c1ccc2c(c1)cc(c[n+]2[O-])N |
| InChI | 1S/C9H8N2O/c10-8-5-7-3-1-2-4-9(7)11(12)6-8/h1-6H,10H2 |
| InChIKey | AZRGIDVVKRNORH-UHFFFAOYSA-N |
| Density | 1.279g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.67°C at 760 mmHg (Cal.) |
| Flash point | 191.28°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Quinolinamine 1-Oxide |