Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-[(4-Amino-3-Tolyl)Amino]Phenol |
|---|---|
| Synonyms | 4-[(4-Amino-3-Methyl-Phenyl)Amino]Phenol; Kayaku Sulphur Blue Rp; Nsc37093 |
| Molecular Structure | ![CAS#: 6219-89-2， 4-[(4-Amino-3-Tolyl)Amino]Phenol](/moreStructures/6219-89-2.gif) |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 |
| CAS Registry Number | 6219-89-2 |
| EINECS | 228-294-8 |
| SMILES | C1=C(C(=CC=C1NC2=CC=C(C=C2)O)N)C |
| InChI | 1S/C13H14N2O/c1-9-8-11(4-7-13(9)14)15-10-2-5-12(16)6-3-10/h2-8,15-16H,14H2,1H3 |
| InChIKey | JGXPJGJSAMZYBO-UHFFFAOYSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.226°C at 760 mmHg (Cal.) |
| Flash point | 188.593°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-[(4-Amino-3-Tolyl)Amino]Phenol |