| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 3-(4-Fluorophenyl)-1H-pyrazol-5-yl trifluoromethanesulfonate |
|---|---|
| Synonyms | 5-(4-fluo |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6F4N2O3S |
| Molecular Weight | 310.22 |
| CAS Registry Number | 623577-34-4 |
| SMILES | c1cc(ccc1c2cc([nH]n2)OS(=O)(=O)C(F)(F)F)F |
| InChI | 1S/C10H6F4N2O3S/c11-7-3-1-6(2-4-7)8-5-9(16-15-8)19-20(17,18)10(12,13)14/h1-5H,(H,15,16) |
| InChIKey | IDBPUBSGYIGWNS-UHFFFAOYSA-N |
| Density | 1.617g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.942°C at 760 mmHg (Cal.) |
| Flash point | 220.474°C (Cal.) |
| Refractive index | 1.525 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Fluorophenyl)-1H-pyrazol-5-yl trifluoromethanesulfonate |