Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Biosynth AG. | Switzerland | Inquire | ||
|---|---|---|---|---|
|
+41 (71) 858-2020 | |||
|
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Classification | Analytical chemistry >> Standard >> Titration standard |
|---|---|
| Name | N-(2-Carboxyethyl)Iminodiacetic Acid |
| Synonyms | 3-(Bis(Carboxymethyl)Amino)Propionic Acid; N,N-Bis(Carboxymethyl)-Beta-Alanine; N-(2-Carboxyethyl)Iminodiacetic Acid |
| Molecular Structure |  |
| Molecular Formula | C7H11NO6 |
| Molecular Weight | 205.17 |
| CAS Registry Number | 6245-75-6 |
| EINECS | 228-360-6 |
| SMILES | C(N(CC(O)=O)CC(O)=O)CC(O)=O |
| InChI | 1S/C7H11NO6/c9-5(10)1-2-8(3-6(11)12)4-7(13)14/h1-4H2,(H,9,10)(H,11,12)(H,13,14) |
| InChIKey | UWRBFYBQPCJRRL-UHFFFAOYSA-N |
| Density | 1.517g/cm3 (Cal.) |
|---|---|
| Melting point | 195°C (Expl.) |
| Boiling point | 495.838°C at 760 mmHg (Cal.) |
| Flash point | 253.674°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-(2-Carboxyethyl)Iminodiacetic Acid |