|
CAS#: 62450-07-1 Product: 1-Methyl-3-amino-5H-pyrido[4,3-b]indole No suppilers available for the product. |
| Name | 1-Methyl-3-amino-5H-pyrido[4,3-b]indole |
|---|---|
| Synonyms | (1-Methyl-5H-Pyrido[4,5-B]Indol-3-Yl)Amine; C14416; 1-Methyl-3-Amino-5H-Pyrido(4,3-B)Indole |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 |
| CAS Registry Number | 62450-07-1 |
| SMILES | C1=CC=CC3=C1C2=C(N=C(C=C2[NH]3)N)C |
| InChI | 1S/C12H11N3/c1-7-12-8-4-2-3-5-9(8)15-10(12)6-11(13)14-7/h2-6,15H,1H3,(H2,13,14) |
| InChIKey | LKKMLIBUAXYLOY-UHFFFAOYSA-N |
| Density | 1.335g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.662°C at 760 mmHg (Cal.) |
| Flash point | 260.108°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-3-amino-5H-pyrido[4,3-b]indole |