|
CAS#: 6247-27-4 Product: Mordant Brown 4 No suppilers available for the product. |
| Classification | Dyes and pigments >> Dyes >> Acid dyestuff |
|---|---|
| Name | Mordant Brown 4 |
| Synonyms | (6E)-6-[(2,4-Diamino-5-Methylphenyl)Hydrazinylidene]-2,4-Dinitrocyclohexa-2,4-Dien-1-One; 6-[(2,4-Diamino-5-Methyl-Phenyl)Hydrazono]-2,4-Dinitro-Cyclohexa-2,4-Dien-1-One; (6E)-6-[(2,4-Diamino-5-Methyl-Phenyl)Hydrazono]-2,4-Dinitro-Cyclohexa-2,4-Dien-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12N6O5 |
| Molecular Weight | 332.28 |
| CAS Registry Number | 6247-27-4 |
| EINECS | 228-362-7 |
| SMILES | C1=C(C(=CC(=C1N\N=C2\C(=O)C(=CC(=C2)[N+]([O-])=O)[N+]([O-])=O)N)N)C |
| InChI | 1S/C13H12N6O5/c1-6-2-10(9(15)5-8(6)14)16-17-11-3-7(18(21)22)4-12(13(11)20)19(23)24/h2-5,16H,14-15H2,1H3/b17-11+ |
| InChIKey | QCEPNSOGSWJPGP-GZTJUZNOSA-N |
| Density | 1.704g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.726°C at 760 mmHg (Cal.) |
| Flash point | 246.954°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Mordant Brown 4 |