Online Database of Chemicals from Around the World
|
CAS#: 6247-99-0 Product: Aloe Emodin Anthrone No suppilers available for the product. |
| Name | Aloe Emodin Anthrone |
|---|---|
| Synonyms | 1,8-Dihydroxy-3-Methylol-10H-Anthracen-9-One; Nsc 658578; Nsc658578 |
| Molecular Structure |  |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 |
| CAS Registry Number | 6247-99-0 |
| SMILES | C3=C(O)C1=C(CC2=C(C1=O)C(=CC=C2)O)C=C3CO |
| InChI | 1S/C15H12O4/c16-7-8-4-10-6-9-2-1-3-11(17)13(9)15(19)14(10)12(18)5-8/h1-5,16-18H,6-7H2 |
| InChIKey | AVZIASIVCYCZND-UHFFFAOYSA-N |
| Density | 1.479g/cm3 (Cal.) |
|---|---|
| Boiling point | 562.323°C at 760 mmHg (Cal.) |
| Flash point | 307.936°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Aloe Emodin Anthrone |