Online Database of Chemicals from Around the World
|
CAS#: 62475-47-2 Product: 8,5'-Cycloadenosine No suppilers available for the product. |
| Name | 8,5'-Cycloadenosine |
|---|---|
| Synonyms | 8,5'-Cycloadenosine; 8,5'-Cycloadenosine Monohydrate |
| Molecular Structure |  |
| Molecular Formula | C10H11N5O4 |
| Molecular Weight | 265.23 |
| CAS Registry Number | 62475-47-2 |
| SMILES | [N]13C(=NC2=C1N=CN=C2N)C(C4OC3C(C4O)O)O |
| InChI | 1S/C10H11N5O4/c11-7-2-8(13-1-12-7)15-9(14-2)5(18)6-3(16)4(17)10(15)19-6/h1,3-6,10,16-18H,(H2,11,12,13) |
| InChIKey | OUMZRLANNPGSAF-UHFFFAOYSA-N |
| Density | 2.662g/cm3 (Cal.) |
|---|---|
| Boiling point | 761.638°C at 760 mmHg (Cal.) |
| Flash point | 414.424°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8,5'-Cycloadenosine |