|
CAS#: 6251-69-0 Product: 11beta,18-Epoxy-18,21-Dihydroxypregn-4-Ene-3,20-Dione No suppilers available for the product. |
| Name | 11beta,18-Epoxy-18,21-Dihydroxypregn-4-Ene-3,20-Dione |
|---|---|
| Synonyms | 11Beta,18-Epoxy-18,21-Dihydroxypregn-4-Ene-3,20-Dione; 11Beta,18-Epoxy-18Xi-Hydroxypregn-4-Ene-3,20-Dione; 18,11-Hemiacetal Of 11Beta,21-Dihydroxy-3,20-Dioxopregn-4-En-18-Al |
| Molecular Structure | ![]() |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 |
| CAS Registry Number | 6251-69-0 |
| SMILES | [C@]345[C@H]([C@H]2[C@@H]([C@@]1(C(=CC(=O)CC1)CC2)C)[C@H](C3)OC4O)CC[C@@H]5C(CO)=O |
| InChI | 1S/C21H28O5/c1-20-7-6-12(23)8-11(20)2-3-13-14-4-5-15(16(24)10-22)21(14)9-17(18(13)20)26-19(21)25/h8,13-15,17-19,22,25H,2-7,9-10H2,1H3/t13-,14-,15+,17-,18+,19?,20-,21+/m0/s1 |
| InChIKey | QUQBHBRVKLEOEI-UBWIUKTRSA-N |
| Density | 1.325g/cm3 (Cal.) |
|---|---|
| Boiling point | 581.273°C at 760 mmHg (Cal.) |
| Flash point | 206.792°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11beta,18-Epoxy-18,21-Dihydroxypregn-4-Ene-3,20-Dione |