Online Database of Chemicals from Around the World
|
CAS#: 62512-94-1 Product: Isogravacridonchlorine No suppilers available for the product. |
| Name | Isogravacridonchlorine |
|---|---|
| Synonyms | Isogravacridonchlorine; Isogravacridone Chlorine |
| Molecular Structure |  |
| Molecular Formula | C19H18ClNO4 |
| Molecular Weight | 359.81 |
| CAS Registry Number | 62512-94-1 |
| SMILES | C3=C(C1=C(N(C)C2=C(C1=O)C=CC=C2)C4=C3OC(C4)C(O)(CCl)C)O |
| InChI | 1S/C19H18ClNO4/c1-19(24,9-20)15-7-11-14(25-15)8-13(22)16-17(11)21(2)12-6-4-3-5-10(12)18(16)23/h3-6,8,15,22,24H,7,9H2,1-2H3 |
| InChIKey | PGOOUZZLZBIMRI-UHFFFAOYSA-N |
| Density | 1.435g/cm3 (Cal.) |
|---|---|
| Boiling point | 618.367°C at 760 mmHg (Cal.) |
| Flash point | 327.777°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isogravacridonchlorine |