|
CAS#: 62586-85-0 Product: 4-Chloro-alpha-Cyclopropyl-alpha-Methylbenzyl Alcohol No suppilers available for the product. |
| Name | 4-Chloro-alpha-Cyclopropyl-alpha-Methylbenzyl Alcohol |
|---|---|
| Synonyms | 1-(4-Chlorophenyl)-1-Cyclopropyl-Ethanol; 4-Chloro-Alpha-Cyclopropyl-Alpha-Methylbenzyl Alcohol |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 |
| CAS Registry Number | 62586-85-0 |
| EINECS | 263-613-4 |
| SMILES | C2=C(C(C1CC1)(C)O)C=CC(=C2)Cl |
| InChI | 1S/C11H13ClO/c1-11(13,8-2-3-8)9-4-6-10(12)7-5-9/h4-8,13H,2-3H2,1H3 |
| InChIKey | OSFCGPVNQAPOHW-UHFFFAOYSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.613°C at 760 mmHg (Cal.) |
| Flash point | 133.187°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-alpha-Cyclopropyl-alpha-Methylbenzyl Alcohol |