Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-(2-Aminophenylthio)Benzenamine |
|---|---|
| Synonyms | 2-[(4-Aminophenyl)Thio]Aniline; [2-[(4-Aminophenyl)Thio]Phenyl]Amine; 2-((4-Aminophenyl)Thio)Benzenamine |
| Molecular Structure |  |
| Molecular Formula | C12H12N2S |
| Molecular Weight | 216.30 |
| CAS Registry Number | 6259-01-4 |
| SMILES | C2=C(SC1=CC=C(N)C=C1)C(=CC=C2)N |
| InChI | 1S/C12H12N2S/c13-9-5-7-10(8-6-9)15-12-4-2-1-3-11(12)14/h1-8H,13-14H2 |
| InChIKey | SDFBOZZUDRGADA-UHFFFAOYSA-N |
| Density | 1.263g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.655°C at 760 mmHg (Cal.) |
| Flash point | 202.762°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2-Aminophenylthio)Benzenamine |