Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3,4,5-Trihydroxybenzanilide |
|---|---|
| Synonyms | 3,4,5-Trihydroxy-N-Phenyl-Benzamide; 2-12-00-00263 (Beilstein Handbook Reference); 3,4,5-Trihydroxybenzanilide |
| Molecular Structure |  |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 |
| CAS Registry Number | 6262-27-7 |
| EINECS | 228-417-5 |
| SMILES | C1=C(C=CC=C1)NC(=O)C2=CC(=C(C(=C2)O)O)O |
| InChI | 1S/C13H11NO4/c15-10-6-8(7-11(16)12(10)17)13(18)14-9-4-2-1-3-5-9/h1-7,15-17H,(H,14,18) |
| InChIKey | HLVGXGQCLASQJU-UHFFFAOYSA-N |
| Density | 1.499g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.774°C at 760 mmHg (Cal.) |
| Flash point | 220.977°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4,5-Trihydroxybenzanilide |